CAS 130497-29-9
:N,N-Dimethyl-2-piperidinecarboxamide
Description:
N,N-Dimethyl-2-piperidinecarboxamide, with the CAS number 130497-29-9, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also attached to two methyl groups (N,N-dimethyl). It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions. The presence of the piperidine ring contributes to its potential as a solvent or reagent in various chemical reactions. N,N-Dimethyl-2-piperidinecarboxamide is known for its moderate polarity, which allows it to dissolve a range of organic compounds. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-10(2)8(11)7-5-3-4-6-9-7/h7,9H,3-6H2,1-2H3
InChI key:InChIKey=NUYUOVYMORENER-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1CCCCN1
Synonyms:- N,N-dimethyl-2-Piperidinecarboxamide
- 2-Piperidinecarboxamide, N,N-dimethyl-
- 2-Piperidinecarboxamide, N,N-dimethyl-, (±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.