CAS 130497-30-2

N,N-Diethyl-2-piperidinecarboxamide

Description:

N,N-Diethyl-2-piperidinecarboxamide, with the CAS number 130497-30-2, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features two ethyl groups attached to the nitrogen atom of the amide functional group, contributing to its lipophilicity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the carboxamide functional group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility in polar solvents. N,N-Diethyl-2-piperidinecarboxamide is of interest in various fields, including medicinal chemistry and pharmacology, due to its potential applications as a pharmaceutical intermediate or active ingredient. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on the molecular environment and conditions under which it is synthesized or stored. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₂₀N₂O

InChI: InChI=1S/C10H20N2O/c1-3-12(4-2)10(13)9-7-5-6-8-11-9/h9,11H,3-8H2,1-2H3

InChI key: InChIKey=BWTDDMYSMJFACO-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(=O)C1CCCCN1

Synonyms:

• 2-Piperidinecarboxamide, N,N-diethyl-, (±)-
• N,N-Diethyl-2-piperidinecarboxamide
• 2-Piperidinecarboxamide, N,N-diethyl-