
CAS 13050-41-4
:N-Ethylhydrazinecarboxamide
Description:
N-Ethylhydrazinecarboxamide, with the CAS number 13050-41-4, is an organic compound characterized by the presence of both hydrazine and carboxamide functional groups. It typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. This compound is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its reactivity and ability to form derivatives. N-Ethylhydrazinecarboxamide may exhibit moderate to high solubility in polar solvents, which is a common trait for compounds containing hydrazine and amide functionalities. It is important to handle this substance with care, as it may pose health risks, including toxicity and potential carcinogenicity. Proper safety measures, including the use of personal protective equipment and adequate ventilation, are essential when working with this chemical. Additionally, its reactivity can lead to the formation of various derivatives, making it a compound of interest in synthetic organic chemistry.
Formula:C3H9N3O
InChI:InChI=1S/C3H9N3O/c1-2-5-3(7)6-4/h2,4H2,1H3,(H2,5,6,7)
InChI key:InChIKey=CJYIAZYTBJVFOT-UHFFFAOYSA-N
SMILES:C(NCC)(NN)=O
Synonyms:- 1-Amino-3-ethylurea
- Hydrazinecarboxamide, N-ethyl-
- 4-Ethylsemicarbazide
- N-Ethylhydrazinecarboxamide
- Semicarbazide, 4-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.