CymitQuimica logo

CAS 130506-81-9

:

Ethanone, 1-[7-[2-(dimethylamino)ethenyl]pyrazolo[1,5-a]pyrimidin-6-yl]-, (E)-

Description:
Ethanone, 1-[7-[2-(dimethylamino)ethenyl]pyrazolo[1,5-a]pyrimidin-6-yl]-, (E)-, with CAS number 130506-81-9, is a chemical compound characterized by its complex structure that includes a pyrazolo-pyrimidine core and a dimethylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the ethenyl group suggests it may participate in addition reactions or polymerization processes. Its E configuration indicates a specific geometric arrangement around the double bond, which can influence its reactivity and interactions. The dimethylamino group may enhance solubility in polar solvents and could also contribute to its pharmacological properties. Overall, this compound is of interest in medicinal chemistry and may be studied for its potential therapeutic applications, particularly in the development of novel pharmaceuticals.
Formula:C12H14N4O
InChI:InChI=1S/C12H14N4O/c1-9(17)10-8-13-12-4-6-14-16(12)11(10)5-7-15(2)3/h4-8H,1-3H3/b7-5+
InChI key:InChIKey=PCLKTEWKPFWQAJ-FNORWQNLSA-N
SMILES:C(=C/N(C)C)\C=1N2C(N=CC1C(C)=O)=CC=N2
Synonyms:
  • Ethanone, 1-[7-[2-(dimethylamino)ethenyl]pyrazolo[1,5-a]pyrimidin-6-yl]-, (E)-
  • Pyrazolo[1,5-a]pyrimidine, ethanone deriv.
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.