CymitQuimica logo

CAS 130507-38-9

:

6-Fluoro-3-methyl-2-phenyl-4-quinolinecarboxylic acid

Description:
6-Fluoro-3-methyl-2-phenyl-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a fluorine atom at the 6-position and a methyl group at the 3-position contributes to its unique chemical properties, while the phenyl group at the 2-position enhances its aromatic character. This compound features a carboxylic acid functional group at the 4-position, which can participate in various chemical reactions, including esterification and acid-base reactions. The fluorine substituent can influence the compound's reactivity, polarity, and potential biological activity. Typically, compounds of this class may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and interaction with biological targets can be influenced by its structural features. Overall, 6-Fluoro-3-methyl-2-phenyl-4-quinolinecarboxylic acid represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C17H12FNO2
InChI:InChI=1S/C17H12FNO2/c1-10-15(17(20)21)13-9-12(18)7-8-14(13)19-16(10)11-5-3-2-4-6-11/h2-9H,1H3,(H,20,21)
InChI key:InChIKey=STGJYFAYYQRGSQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1C)C3=CC=CC=C3)C=CC(F)=C2
Synonyms:
  • 4-Quinolinecarboxylic acid, 6-fluoro-3-methyl-2-phenyl-
  • 6-Fluoro-3-methyl-2-phenylquinoline-4-carboxylic acid
  • 6-Fluoro-3-methyl-2-phenyl-4-quinolinecarboxylic acid
Found 2 products.