CAS 13051-12-2
:4-chloro-4-methyl-5-(4-nitrophenyl)-2,4-dihydro-3H-pyrazol-3-one
Description:
4-Chloro-4-methyl-5-(4-nitrophenyl)-2,4-dihydro-3H-pyrazol-3-one, with the CAS number 13051-12-2, is a chemical compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound exhibits a range of functional groups, including a chloro group, a methyl group, and a nitrophenyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group suggests potential for electrophilic reactivity, while the chloro and methyl groups can influence its overall reactivity and stability. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis and reactivity can be influenced by the electronic effects of the substituents, making it a subject of study in organic chemistry and medicinal chemistry. Safety data should be consulted for handling and usage, as compounds with nitro and chloro groups can pose health and environmental risks.
Formula:C10H8ClN3O3
InChI:InChI=1/C10H8ClN3O3/c1-10(11)8(12-13-9(10)15)6-2-4-7(5-3-6)14(16)17/h2-5H,1H3,(H,13,15)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3H-Pyrazol-3-one, 4-chloro-2,4-dihydro-4-methyl-5-(4-nitrophenyl)-
CAS:Formula:C10H8ClN3O3Molecular weight:253.6418
