
CAS 13051-60-0
:rel-(2R,3S)-2,3-Diethenyloxirane
Description:
Rel-(2R,3S)-2,3-Diethenyloxirane, also known as a chiral epoxide, is a chemical compound characterized by its three-membered cyclic ether structure containing an epoxide functional group. This compound features two ethylene groups attached to the carbon atoms of the epoxide, contributing to its reactivity and potential applications in organic synthesis. The specific stereochemistry indicated by the (2R,3S) configuration suggests that it has distinct spatial arrangements, which can influence its chemical behavior and interactions with other molecules. As an epoxide, it is known for its ability to undergo ring-opening reactions, making it a valuable intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. The presence of the double bonds in the ethylene groups also allows for further functionalization, enhancing its versatility in chemical reactions. Overall, rel-(2R,3S)-2,3-Diethenyloxirane is notable for its unique structural features and reactivity, which are of interest in both academic research and industrial applications.
Formula:C6H8O
InChI:InChI=1/C6H8O/c1-3-5-6(4-2)7-5/h3-6H,1-2H2/t5-,6+
InChI key:InChIKey=WVLXAFYCRVAZSM-OLQVQODUNA-N
SMILES:C(=C)[C@H]1[C@@H](C=C)O1
Synonyms:- rel-(2R,3S)-2,3-Diethenyloxirane
- Oxirane, 2,3-diethenyl-, cis-
- 3,4-Epoxy-1,5-hexadiene
- 1,5-Hexadiene, 3,4-epoxy-, cis-
- Oxirane, 2,3-diethenyl-, (2R,3S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
