
CAS 13051-61-1
:Oxirane, 2,3-diethenyl-, (2R,3R)-rel-
Description:
Oxirane, 2,3-diethenyl-, (2R,3R)-rel- is a chiral organic compound characterized by its epoxide structure, which features a three-membered cyclic ether known as an oxirane. This compound contains two vinyl groups (ethenyl) attached to the carbon atoms of the oxirane ring, contributing to its reactivity and potential applications in organic synthesis. The (2R,3R)-rel- designation indicates its specific stereochemistry, which can influence its chemical behavior and interactions with other molecules. Typically, compounds like this are used in polymer chemistry, particularly in the synthesis of various polymers and copolymers, due to their ability to undergo ring-opening reactions. Additionally, the presence of the double bonds in the vinyl groups allows for further functionalization and cross-linking, making it valuable in the production of advanced materials. Safety considerations should be taken into account, as epoxides can be reactive and may pose health risks if not handled properly.
Formula:C6H8O
InChI:InChI=1/C6H8O/c1-3-5-6(4-2)7-5/h3-6H,1-2H2/t5-,6-/s2
InChI key:InChIKey=WVLXAFYCRVAZSM-IOMOGOHMNA-N
SMILES:C(=C)[C@H]1[C@H](C=C)O1
Synonyms:- Oxirane, 2,3-diethenyl-, (2R,3R)-rel-
- Oxirane, 2,3-diethenyl-, trans-
- 1,5-Hexadiene, 3,4-epoxy-, trans-
- trans-2,3-Divinyloxirane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
