CymitQuimica logo

CAS 13051-91-7

:

rel-(1R,2S)-2-Methoxycyclopentanol

Description:
Rel-(1R,2S)-2-Methoxycyclopentanol is a chiral organic compound characterized by its cyclopentane ring structure with a methoxy group (-OCH3) and a hydroxyl group (-OH) attached to the second carbon. This compound exhibits stereoisomerism due to the presence of chiral centers, which influences its physical and chemical properties, including solubility and reactivity. It is typically a colorless to pale yellow liquid at room temperature and has a moderate boiling point. The presence of both the methoxy and hydroxyl functional groups contributes to its potential as a solvent and reagent in organic synthesis. Additionally, the compound may exhibit hydrogen bonding due to the hydroxyl group, affecting its interactions with other molecules. Its specific applications can vary, but it is often explored in the context of organic chemistry for its potential use in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H12O2
InChI:InChI=1/C6H12O2/c1-8-6-4-2-3-5(6)7/h5-7H,2-4H2,1H3/t5-,6+/s2
InChI key:InChIKey=YVXLDOASGKIXII-MZQZIECVNA-N
SMILES:O(C)[C@H]1[C@@H](O)CCC1
Synonyms:
  • cis-2-Methoxycyclopentanol
  • cis-2-Methoxypentanol
  • rel-(1R,2S)-2-Methoxycyclopentanol
  • Cyclopentanol, 2-methoxy-, cis-
  • Cyclopentanol, 2-methoxy-, (1R,2S)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.