CymitQuimica logo

CAS 130516-99-3

:

4-[2-(2-methyl-1H-imidazol-1-yl)ethyl]piperidine

Description:
4-[2-(2-methyl-1H-imidazol-1-yl)ethyl]piperidine, identified by its CAS number 130516-99-3, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a side chain that includes a 2-methyl-1H-imidazole moiety, contributing to its potential biological activity. The presence of the imidazole ring suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the context of drug design and development. The compound is likely to be a polar molecule due to the nitrogen atoms in both the piperidine and imidazole rings, which can influence its solubility and interaction with biological targets. Additionally, the structural features may allow for hydrogen bonding, impacting its pharmacokinetic properties. Overall, this compound's unique structure positions it as a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C11H19N3
InChI:InChI=1/C11H19N3/c1-10-13-7-9-14(10)8-4-11-2-5-12-6-3-11/h7,9,11-12H,2-6,8H2,1H3
SMILES:Cc1nccn1CCC1CCNCC1
Synonyms:
  • piperidine, 4-[2-(2-methyl-1H-imidazol-1-yl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.