CymitQuimica logo

CAS 1305207-83-3

:

1,1-Dimethylethyl 5-[(phenylmethyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate

Description:
1,1-Dimethylethyl 5-[(phenylmethyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate, identified by its CAS number 1305207-83-3, is a chemical compound characterized by its complex bicyclic structure, which includes a nitrogen atom within a seven-membered ring. This compound features a dimethyl group attached to a tertiary carbon, contributing to its steric bulk and potentially influencing its reactivity and interactions. The presence of a phenylmethylamino group suggests that it may exhibit significant biological activity, possibly interacting with various receptors or enzymes. The carboxylate functional group indicates that it can participate in acid-base reactions and may be involved in forming salts or esters. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature, making it essential to consider these factors in practical applications. Overall, this compound represents a unique blend of structural complexity and potential biological relevance.
Formula:C18H26N2O2
InChI:InChI=1S/C18H26N2O2/c1-18(2,3)22-17(21)20-12-14-9-15(20)10-16(14)19-11-13-7-5-4-6-8-13/h4-8,14-16,19H,9-12H2,1-3H3
InChI key:InChIKey=HFIAICRLCXYAAE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2CC(C1)C(NCC3=CC=CC=C3)C2
Synonyms:
  • 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-[(phenylmethyl)amino]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 5-[(phenylmethyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.