
CAS 130523-93-2
:(9Z,13Z,15E)-14,18-Dihydroxy-12-oxo-9,13,15-octadecatrienoic acid
Description:
(9Z,13Z,15E)-14,18-Dihydroxy-12-oxo-9,13,15-octadecatrienoic acid, commonly referred to as a type of hydroxy fatty acid, is characterized by its multiple double bonds and hydroxyl groups, which contribute to its reactivity and potential biological activity. This compound features a long carbon chain typical of fatty acids, with specific geometric configurations at the double bonds, denoted by the Z and E designations. The presence of hydroxyl groups indicates that it may participate in hydrogen bonding, influencing its solubility and interaction with biological membranes. The keto group at the 12-position adds to its reactivity, potentially allowing for further chemical transformations. This compound is of interest in biochemical research, particularly in the study of lipid metabolism and signaling pathways. Its structural complexity suggests potential roles in various physiological processes, including inflammation and cell signaling. Overall, the unique arrangement of functional groups and the unsaturation of the carbon chain make it a significant molecule in the context of biochemistry and pharmacology.
Formula:C18H28O5
InChI:InChI=1S/C18H28O5/c19-14-10-9-12-17(21)15-16(20)11-7-5-3-1-2-4-6-8-13-18(22)23/h5,7,9,12,15,19,21H,1-4,6,8,10-11,13-14H2,(H,22,23)/b7-5-,12-9+,17-15-
InChI key:InChIKey=LFTUCYCUYUJMJB-YXCOHMLOSA-N
SMILES:C(\C(C/C=C\CCCCCCCC(O)=O)=O)=C(/C=C/CCO)\O
Synonyms:- (9Z,13Z,15E)-14,18-Dihydroxy-12-oxo-9,13,15-octadecatrienoic acid
- Cibaric acid
- 9,13,15-Octadecatrienoic acid, 14,18-dihydroxy-12-oxo-, (9Z,13Z,15E)-
- 9,13,15-Octadecatrienoic acid, 14,18-dihydroxy-12-oxo-, (Z,E,Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9,13,15-Octadecatrienoic acid, 14,18-dihydroxy-12-oxo-, (9Z,13Z,15E)-
CAS:Formula:C18H28O5Molecular weight:324.4119
