CAS 130525-62-1
:4-amino-2-deoxy-2,3-didehydro-N-acetylneuraminic acid
Description:
4-Amino-2-deoxy-2,3-didehydro-N-acetylneuraminic acid, commonly referred to as a derivative of sialic acid, is a naturally occurring amino sugar that plays a crucial role in various biological processes. This compound features an amino group and an N-acetyl group, contributing to its biochemical properties. It is characterized by its ability to participate in cell recognition and signaling, particularly in the context of viral infections and immune responses. The presence of the didehydro structure indicates that it has undergone specific modifications that can influence its reactivity and interactions with other biomolecules. This compound is soluble in water and exhibits polar characteristics due to its functional groups. Its structural features allow it to engage in hydrogen bonding, which is essential for its biological activity. Overall, 4-amino-2-deoxy-2,3-didehydro-N-acetylneuraminic acid is significant in glycobiology and has potential implications in therapeutic research, particularly concerning viral pathogenesis and immune modulation.
Formula:C11H18N2O7
InChI:InChI=1/C11H18N2O7/c1-4(15)13-8-5(12)2-7(11(18)19)20-10(8)9(17)6(16)3-14/h2,5-6,8-10,14,16-17H,3,12H2,1H3,(H,13,15)(H,18,19)/t5-,6-,8?,9-,10+/m0/s1
Synonyms:- (4S,5R,6R)-5-Acetamido-4-Amino-6-[(1R,2R)-1,2,3-Trihydroxypropyl]-5,6-Dihydropyran-2-Carboxylic Acid
- (5xi)-5-(acetylamino)-4-amino-2,6-anhydro-3,4,5-trideoxy-L-altro-non-2-enonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(Acetylamino)-4-amino-2,6-anhydro-3,4,5-trideoxy-D-glycero-D-galacto-non-2-enonic acid
CAS:Formula:C11H18N2O7Color and Shape:SolidMolecular weight:290.2698Zanamivir Amine
CAS:Controlled ProductStability Hygroscopic
Applications A synthetic precursor of Zanamivir.
References Gonzalez-Diaz, H., et al.: Bioorg. Med. Chem. Lett., 15, 1651 (2005), Bergmann, R., et al.: J. Med. Chem., 50, 2708 (2007), Lue, W., et al.: Eur. J. Med. Chem., 43, 569 (2008),Formula:C11H18N2O7Color and Shape:NeatMolecular weight:290.27Zanamivir amine
CAS:Anti-viral; influenza neuraminidase inhibitorFormula:C11H18N2O7Purity:Min. 95%Color and Shape:PowderMolecular weight:290.27 g/mol




