
CAS 130525-75-6
:Dibutyl 2-[[4-chloro-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]oxy]ethyl phosphate
Description:
Dibutyl 2-[[4-chloro-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]oxy]ethyl phosphate, with CAS number 130525-75-6, is an organophosphate compound characterized by its phosphate ester structure. It features a dibutyl group, which contributes to its hydrophobic properties, and a triazine moiety that enhances its stability and potential biological activity. The presence of a chloro substituent and a trimethylphenoxy group indicates that it may exhibit specific interactions with biological systems, potentially serving as a herbicide or pesticide. This compound is typically used in agricultural applications due to its effectiveness in controlling various pests. Its chemical stability, solubility in organic solvents, and ability to penetrate plant tissues are significant characteristics that influence its efficacy. However, like many organophosphates, it may pose environmental and health risks, necessitating careful handling and regulation. Understanding its properties, including its reactivity and potential toxicity, is crucial for safe application and environmental impact assessments.
Formula:C22H33ClN3O6P
InChI:InChI=1S/C22H33ClN3O6P/c1-6-8-10-29-33(27,30-11-9-7-2)31-13-12-28-21-24-20(23)25-22(26-21)32-19-17(4)14-16(3)15-18(19)5/h14-15H,6-13H2,1-5H3
InChI key:InChIKey=KBJJFMDOKMEDBA-UHFFFAOYSA-N
SMILES:O(C=1N=C(OCCOP(OCCCC)(OCCCC)=O)N=C(Cl)N1)C2=C(C)C=C(C)C=C2C
Synonyms:- Dibutyl 2-[[4-chloro-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]oxy]ethyl phosphate
- Phosphoric acid, dibutyl 2-[[4-chloro-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]oxy]ethyl ester
- 2-Chloro-4-(2-dibutylphosphatoethoxy)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phosphoric acid, dibutyl 2-[[4-chloro-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]oxy]ethyl ester
CAS:Formula:C22H33ClN3O6PMolecular weight:501.9407
