CAS 13053-61-7
:Z-His-Phe-Phe-OEt
Description:
Z-His-Phe-Phe-OEt, also known as Z-β-histidyl-phenylalanylleucine ethyl ester, is a synthetic peptide derivative characterized by its specific amino acid sequence and protective groups. The "Z" indicates the presence of a benzyloxycarbonyl (Z) protecting group on the N-terminus, which is commonly used to enhance stability and solubility during synthesis. The peptide consists of histidine (His) and phenylalanine (Phe) residues, contributing to its potential biological activity and interactions. The ethyl ester (OEt) at the C-terminus can influence the compound's solubility and permeability, making it relevant for pharmaceutical applications. This compound may exhibit properties such as antimicrobial activity, and its structure allows for interactions with various biological targets, making it of interest in medicinal chemistry and peptide research. As with many peptides, its stability, solubility, and biological activity can be influenced by environmental factors such as pH and temperature.
Formula:C34H37N5O6
InChI:InChI=1/C34H37N5O6/c1-2-44-33(42)30(19-25-14-8-4-9-15-25)38-31(40)28(18-24-12-6-3-7-13-24)37-32(41)29(20-27-21-35-23-36-27)39-34(43)45-22-26-16-10-5-11-17-26/h3-17,21,23,28-30H,2,18-20,22H2,1H3,(H,35,36)(H,37,41)(H,38,40)(H,39,43)
SMILES:CCOC(=O)C(Cc1ccccc1)N=C(C(Cc1ccccc1)N=C(C(Cc1cnc[nH]1)N=C(O)OCc1ccccc1)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Z-His-Phe-Phe-OEt
CAS:Z-His-Phe-Phe-OEt is a synthetic, polyacrylamide gel-based experiment that determines the amino acid composition of imidazolium zymogens. This experiment utilizes an ion-exchange chromatography technique to separate and identify peptides. The solvents used in this experiment are acetone and ion-exchange chromatography. In order to carry out this experiment, one must first dissolve the polyacrylamide gel in a system of solvents with a pH of 7.5 or lower in order to create an electrofocusing environment. This solution is then applied to the polyacrylamide gel, which will form a solid film when dried. The imidazolium zymogen can then be cleaved by pepsin, yielding peptides that can be analysed using mass spectrometry.Formula:C34H37N5O6Purity:Min. 95%Molecular weight:611.69 g/mol
