
CAS 13053-89-9
:N-2-Pyrimidinylbenzamide
Description:
N-2-Pyrimidinylbenzamide, with the CAS number 13053-89-9, is a chemical compound characterized by its structure, which features a pyrimidine ring substituted with a benzamide group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity. The presence of the pyrimidine moiety may impart biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. The compound may also exhibit specific reactivity patterns due to the functional groups present, allowing for potential derivatization or interaction with other chemical entities. Its melting point, boiling point, and other physical properties would depend on the specific conditions and purity of the sample. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, N-2-Pyrimidinylbenzamide represents a versatile structure in organic chemistry with implications in medicinal chemistry and material science.
Formula:C11H9N3O
InChI:InChI=1S/C11H9N3O/c15-10(9-5-2-1-3-6-9)14-11-12-7-4-8-13-11/h1-8H,(H,12,13,14,15)
InChI key:InChIKey=QBRCMHSAOZCHQH-UHFFFAOYSA-N
SMILES:C(NC=1N=CC=CN1)(=O)C2=CC=CC=C2
Synonyms:- Pyrimidine, 2-benzamido-
- Benzamide, N-2-pyrimidinyl-
- N-2-Pyrimidinylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
