CAS 1305323-94-7

1-(2,6-Difluoro-3-methylphenyl)-2-propanone

Description:

1-(2,6-Difluoro-3-methylphenyl)-2-propanone, identified by its CAS number 1305323-94-7, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of two fluorine atoms at the 2 and 6 positions of the phenyl ring contributes to its unique chemical properties, including increased electronegativity and potential for enhanced reactivity. The methyl group at the 3 position further influences its steric and electronic characteristics. This compound is likely to exhibit moderate polarity due to the ketone group, affecting its solubility in various solvents. Additionally, the fluorine substituents may impart specific biological activity or influence its interaction with other chemical species. As a ketone, it may participate in typical reactions associated with carbonyl compounds, such as nucleophilic addition. Overall, 1-(2,6-Difluoro-3-methylphenyl)-2-propanone is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, depending on its reactivity and biological properties.

Formula: C₁₀H₁₀F₂O

InChI: InChI=1S/C10H10F2O/c1-6-3-4-9(11)8(10(6)12)5-7(2)13/h3-4H,5H2,1-2H3

InChI key: InChIKey=NMLYUWZDQOPADA-UHFFFAOYSA-N

SMILES: C(C(C)=O)C1=C(F)C(C)=CC=C1F

Synonyms:

• 2-Propanone, 1-(2,6-difluoro-3-methylphenyl)-
• 1-(2,6-Difluoro-3-methylphenyl)-2-propanone