CAS 1305323-99-2

1-(2,3,5-Trifluorophenyl)-2-propanone

Description:

1-(2,3,5-Trifluorophenyl)-2-propanone, identified by its CAS number 1305323-99-2, is an organic compound characterized by the presence of a trifluorophenyl group attached to a propanone moiety. This compound features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The trifluoromethyl substituents on the phenyl ring enhance the compound's lipophilicity and may influence its electronic properties, making it of interest in medicinal chemistry and material science. The presence of fluorine atoms typically imparts unique characteristics such as increased stability and altered solubility compared to non-fluorinated analogs. Additionally, the compound may exhibit interesting biological activities, which could be explored for pharmaceutical applications. Its synthesis and reactivity can be influenced by the steric and electronic effects of the trifluorophenyl group, making it a valuable compound for research in various chemical fields. Safety data and handling precautions should be considered due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₉H₇F₃O

InChI: InChI=1S/C9H7F3O/c1-5(13)2-6-3-7(10)4-8(11)9(6)12/h3-4H,2H2,1H3

InChI key: InChIKey=NMQNVEYESYZLGB-UHFFFAOYSA-N

SMILES: C(C(C)=O)C1=C(F)C(F)=CC(F)=C1

Synonyms:

• 1-(2,3,5-Trifluorophenyl)propan-2-one
• 2-Propanone, 1-(2,3,5-trifluorophenyl)-
• 1-(2,3,5-Trifluorophenyl)-2-propanone