CAS 1305324-08-6

1-(2-Phenoxyphenyl)-2-propanone

Description:

1-(2-Phenoxyphenyl)-2-propanone, also known by its CAS number 1305324-08-6, is an organic compound characterized by its ketone functional group and the presence of phenoxy and phenyl substituents. This compound typically appears as a solid or viscous liquid, depending on its purity and specific conditions. It is known for its role in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the phenoxy group contributes to its potential reactivity and solubility properties, making it useful in various chemical reactions, including photochemical processes. Additionally, its structure suggests potential applications in materials science, particularly in the development of polymers or coatings. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with its use. Overall, 1-(2-Phenoxyphenyl)-2-propanone is a compound of interest in both academic and industrial chemistry contexts.

Formula: C₁₅H₁₄O₂

InChI: InChI=1S/C15H14O2/c1-12(16)11-13-7-5-6-10-15(13)17-14-8-3-2-4-9-14/h2-10H,11H2,1H3

InChI key: InChIKey=VWFRDWVKFQONRY-UHFFFAOYSA-N

SMILES: O(C1=C(CC(C)=O)C=CC=C1)C2=CC=CC=C2

Synonyms:

• 2-Propanone, 1-(2-phenoxyphenyl)-
• 1-(2-Phenoxyphenyl)-2-propanone