CAS 1305324-54-2
:2-Chloro-3-[(2,2-dimethyl-1-oxopropyl)amino]-6-iodo-4-pyridinecarboxylic acid
Description:
2-Chloro-3-[(2,2-dimethyl-1-oxopropyl)amino]-6-iodo-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a chloro group and an iodo group indicates that the compound may exhibit unique reactivity and potential for halogenation reactions. The amino group, attached to a branched alkyl chain, suggests that the compound may have basic properties and could participate in hydrogen bonding. This compound is likely to be polar due to the presence of the carboxylic acid functional group, which can also contribute to its solubility in polar solvents. Additionally, the presence of multiple substituents may influence its biological activity, making it of interest in pharmaceutical research. The specific arrangement of atoms and functional groups in this compound can lead to diverse chemical behavior, including potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry.
Formula:C11H12ClIN2O3
InChI:InChI=1S/C11H12ClIN2O3/c1-11(2,3)10(18)15-7-5(9(16)17)4-6(13)14-8(7)12/h4H,1-3H3,(H,15,18)(H,16,17)
InChI key:InChIKey=SQTRSSAQBJDIFE-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C(C(O)=O)=CC(I)=NC1Cl
Synonyms:- 4-Pyridinecarboxylic acid, 2-chloro-3-[(2,2-dimethyl-1-oxopropyl)amino]-6-iodo-
- 2-Chloro-3-[(2,2-dimethyl-1-oxopropyl)amino]-6-iodo-4-pyridinecarboxylic acid
- 2-Chloro-6-iodo-3-pivalamidoisonicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.