CAS 1305324-56-4

2-Bromo-4,5-dichloro-6-iodo-3-methoxypyridine

Description:

2-Bromo-4,5-dichloro-6-iodo-3-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with various halogen atoms and a methoxy group. The presence of bromine, chlorine, and iodine in its structure contributes to its reactivity and potential applications in medicinal chemistry and agrochemicals. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the electronegative halogens and the methoxy group, affecting its interaction with biological targets. Additionally, the presence of multiple halogens can impart unique properties such as increased lipophilicity and potential for halogen bonding. Its synthesis and manipulation require careful handling due to the reactivity of the halogen substituents. Overall, 2-Bromo-4,5-dichloro-6-iodo-3-methoxypyridine is a complex molecule with potential utility in various chemical and pharmaceutical applications, warranting further investigation into its properties and reactivity.

Formula: C₆H₃BrCl₂INO

InChI: InChI=1S/C6H3BrCl2INO/c1-12-4-2(8)3(9)6(10)11-5(4)7/h1H3

InChI key: InChIKey=DELIJYMGNUJWKI-UHFFFAOYSA-N

SMILES: O(C)C=1C(Cl)=C(Cl)C(I)=NC1Br

Synonyms:

• 2-Bromo-4,5-dichloro-6-iodo-3-methoxypyridine
• Pyridine, 2-bromo-4,5-dichloro-6-iodo-3-methoxy-