CAS 1305324-58-6
:7-Chloro-2,3-dihydro-8-(trimethylsilyl)-1,4-dioxino[2,3-b]pyridine
Description:
7-Chloro-2,3-dihydro-8-(trimethylsilyl)-1,4-dioxino[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a dioxin moiety. The presence of a chlorine atom at the 7-position and a trimethylsilyl group at the 8-position contributes to its chemical reactivity and solubility properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and the silicon-containing silyl group, which can enhance its stability and reactivity in various chemical environments. The dioxin ring system may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in organic synthesis and material science, particularly in the development of novel pharmaceuticals or agrochemicals. Its CAS number, 1305324-58-6, allows for precise identification and retrieval of information regarding its properties and applications in scientific literature.
Formula:C10H14ClNO2Si
InChI:InChI=1S/C10H14ClNO2Si/c1-15(2,3)9-7(11)6-12-10-8(9)13-4-5-14-10/h6H,4-5H2,1-3H3
InChI key:InChIKey=QLBAIHABKWUNLW-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=C2C(=NC=C1Cl)OCCO2
Synonyms:- 1,4-Dioxino[2,3-b]pyridine, 7-chloro-2,3-dihydro-8-(trimethylsilyl)-
- 7-Chloro-2,3-dihydro-8-(trimethylsilyl)-1,4-dioxino[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.