CAS 1305324-59-7
:4-Bromo-7-chloro-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine
Description:
4-Bromo-7-chloro-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine is a heterocyclic compound characterized by its complex structure, which includes a fused oxazole and pyridine ring system. This compound features multiple halogen substituents, specifically bromine, chlorine, and iodine, which can significantly influence its reactivity and biological activity. The presence of the bulky 1,1-dimethylethyl group enhances its lipophilicity, potentially affecting its solubility and interaction with biological membranes. The unique arrangement of halogens and the oxazole-pyridine framework may contribute to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure suggests it may exhibit interesting electronic properties, making it a candidate for further study in material science or as a ligand in coordination chemistry. Overall, the combination of its structural features and substituents positions 4-Bromo-7-chloro-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine as a compound of interest in various fields of chemical research.
Formula:C10H9BrClIN2O
InChI:InChI=1S/C10H9BrClIN2O/c1-10(2,3)9-14-5-6(16-9)4(12)8(13)15-7(5)11/h1-3H3
InChI key:InChIKey=PFWCCBWRZODRHP-UHFFFAOYSA-N
SMILES:BrC1=C2C(OC(C(C)(C)C)=N2)=C(Cl)C(I)=N1
Synonyms:- 4-Bromo-7-chloro-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine
- Oxazolo[4,5-c]pyridine, 4-bromo-7-chloro-2-(1,1-dimethylethyl)-6-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.