CymitQuimica logo

CAS 1305324-60-0

:

N-(4-Cyano-5-fluoro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide

Description:
N-(4-Cyano-5-fluoro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with cyano, fluoro, and iodo groups. The presence of these halogen and cyano substituents contributes to its unique reactivity and potential biological activity. The amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. This compound is likely to exhibit properties typical of pyridine derivatives, such as moderate polarity and potential for coordination with metal ions. Its specific substitutions may also impart unique pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular weight, melting point, and solubility characteristics would depend on its specific structure and substituents, which can affect its behavior in various chemical environments. Overall, this compound represents a class of molecules that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H11FIN3O
InChI:InChI=1S/C11H11FIN3O/c1-11(2,3)10(17)16-9-8(13)6(4-14)7(12)5-15-9/h5H,1-3H3,(H,15,16,17)
InChI key:InChIKey=NEYLPDAXAYJYQW-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C(I)C(C#N)=C(F)C=N1
Synonyms:
  • Propanamide, N-(4-cyano-5-fluoro-3-iodo-2-pyridinyl)-2,2-dimethyl-
  • N-(4-Cyano-5-fluoro-3-iodo-2-pyridinyl)-2,2-dimethylpropanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.