CymitQuimica logo

CAS 1305324-65-5

:

5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridin-4-ol

Description:
5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridin-4-ol is a heterocyclic organic compound characterized by its unique pyrrolo-pyridine structure, which incorporates both chlorine and iodine substituents. This compound features a pyrrole ring fused to a pyridine ring, contributing to its potential biological activity. The presence of halogen atoms, specifically chlorine and iodine, can influence its reactivity and solubility, often enhancing its pharmacological properties. The hydroxyl group (-OH) at the 4-position of the pyridine ring may also play a crucial role in its chemical behavior, potentially participating in hydrogen bonding and influencing its interaction with biological targets. Such compounds are of interest in medicinal chemistry for their potential applications in drug development, particularly in targeting specific enzymes or receptors. Additionally, the structural complexity and halogenation may impart unique electronic properties, making it a candidate for further research in various chemical and biological contexts.
Formula:C7H4ClIN2O
InChI:InChI=1S/C7H4ClIN2O/c8-4-5(12)3-1-2-10-7(3)11-6(4)9/h1-2H,(H2,10,11,12)
InChI key:InChIKey=BTPHFLZBMKUKQV-UHFFFAOYSA-N
SMILES:OC1=C2C(=NC(I)=C1Cl)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-4-ol, 5-chloro-6-iodo-
  • 5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridin-4-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.