CAS 1305324-68-8

2-Chloro-5-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

Description:

2-Chloro-5-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with a chlorine atom at the 2-position and an iodine atom at the 5-position. The presence of a phenylsulfonyl group enhances its chemical reactivity and solubility properties. This compound is typically of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its unique combination of halogen substituents may influence its electronic properties and interactions with biological targets. Additionally, the sulfonyl group can serve as a versatile functional handle for further chemical modifications. The compound's molecular structure suggests potential applications in areas such as drug design, where the balance of lipophilicity and hydrophilicity is crucial for bioavailability. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and application.

Formula: C₁₃H₈ClIN₂O₂S

InChI: InChI=1S/C13H8ClIN2O2S/c14-12-7-9-6-10(15)8-16-13(9)17(12)20(18,19)11-4-2-1-3-5-11/h1-8H

InChI key: InChIKey=MAHKWBKFIWRCPH-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C=C1Cl)=CC(I)=CN2)C3=CC=CC=C3

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 2-chloro-5-iodo-1-(phenylsulfonyl)-
• 2-Chloro-5-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
• 1-(Benzenesulfonyl)-2-chloro-5-iodopyrrolo[2,3-b]pyridine