CAS 1305324-69-9
:N-(2-Chloro-4-formyl-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2-Chloro-4-formyl-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro, formyl, and iodo group, alongside a dimethylpropanamide moiety. The presence of the pyridine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The chloro and iodo substituents may influence the compound's reactivity and solubility, while the formyl group can participate in further chemical transformations. The dimethylpropanamide portion contributes to the compound's overall hydrophobic character, which may affect its bioavailability and interaction with biological membranes. Additionally, the compound's molecular structure indicates potential for hydrogen bonding and dipole interactions, which are critical for its biological activity. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest for further research in chemical synthesis and biological applications.
Formula:C11H12ClIN2O2
InChI:InChI=1S/C11H12ClIN2O2/c1-11(2,3)10(17)15-8-6(5-16)4-7(13)14-9(8)12/h4-5H,1-3H3,(H,15,17)
InChI key:InChIKey=MMVSWMJPBMJMRK-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C(C=O)=CC(I)=NC1Cl
Synonyms:- N-(2-Chloro-4-formyl-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide
- Propanamide, N-(2-chloro-4-formyl-6-iodo-3-pyridinyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.