CymitQuimica logo

CAS 1305324-71-3

:

5-Chloro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine

Description:
5-Chloro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrrolopyridine core, halogen substituents, and multiple silyl groups. The presence of chlorine and iodine atoms introduces significant reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The trimethylsilyl and tris(1-methylethyl)silyl groups enhance the compound's stability and solubility, facilitating its use in organic synthesis. This compound may exhibit interesting electronic properties due to the conjugated system formed by the pyrrolopyridine structure, which can influence its behavior in chemical reactions and interactions with biological targets. Additionally, the bulky silyl groups can provide steric hindrance, potentially affecting its reactivity and selectivity in chemical transformations. Overall, this compound represents a versatile building block for further chemical exploration and application in advanced materials and pharmaceuticals.
Formula:C19H32ClIN2Si2
InChI:InChI=1S/C19H32ClIN2Si2/c1-12(2)25(13(3)4,14(5)6)23-11-10-15-17(24(7,8)9)16(20)18(21)22-19(15)23/h10-14H,1-9H3
InChI key:InChIKey=IJKXEXIAUBBVMC-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C([Si](C)(C)C)C(Cl)=C(I)N2
Synonyms:
  • 5-Chloro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.