CymitQuimica logo

CAS 1305324-73-5

:

7-Chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde

Description:
7-Chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a dioxin moiety. The presence of a chlorine atom at the 7-position and an aldehyde functional group at the 8-position contributes to its reactivity and potential biological activity. This compound is typically a pale yellow solid and is soluble in organic solvents, reflecting its polar functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often associated with various biological activities. The dioxin component may also impart specific chemical properties, such as stability and reactivity under certain conditions. As with many heterocycles, the compound's properties can be influenced by substituents, making it a subject of interest for further research in synthetic and medicinal chemistry. Safety and handling precautions should be observed, as with any chemical compound, particularly those with halogen substituents.
Formula:C8H6ClNO3
InChI:InChI=1S/C8H6ClNO3/c9-6-3-10-8-7(5(6)4-11)12-1-2-13-8/h3-4H,1-2H2
InChI key:InChIKey=PSECYSWMKINNMW-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(=NC=C1Cl)OCCO2
Synonyms:
  • 7-Chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxaldehyde
  • 1,4-Dioxino[2,3-b]pyridine-8-carboxaldehyde, 7-chloro-2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.