CymitQuimica logo

CAS 1305324-76-8

:

1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-chloro-, methyl ester

Description:
1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-chloro-, methyl ester is a chemical compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. This compound features a carboxylic acid functional group that is esterified with a methyl group, as indicated by the "methyl ester" designation. The presence of a chlorine atom at the 5-position of the pyridine ring introduces additional reactivity and influences the compound's physical and chemical properties. Typically, such compounds exhibit moderate to high solubility in organic solvents and may have varying solubility in water, depending on the specific substituents and their interactions. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many heterocyclic compounds, the synthesis and characterization of this substance are crucial for understanding its reactivity and potential applications.
Formula:C9H7ClN2O2
InChI:InChI=1S/C9H7ClN2O2/c1-14-9(13)7-6(10)4-5-2-3-11-8(5)12-7/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=HQNDHSJKQGJUKN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C2C(=CC1Cl)C=CN2
Synonyms:
  • Methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-6-carboxylate
  • 1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 5-chloro-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.