CAS 1305324-80-4

4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridin-7-ol

Description:

4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridin-7-ol is a heterocyclic compound characterized by the presence of both bromine and an oxazole ring fused to a pyridine structure. This compound features a bulky tert-butyl group, which can influence its solubility and reactivity. The bromine atom introduces electrophilic characteristics, making it a potential candidate for further chemical modifications. The hydroxyl group at the 7-position of the pyridine contributes to its polarity and can participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry. The overall structure suggests that it may exhibit interesting biological activities, possibly as a pharmaceutical agent or in agrochemical applications. Its unique combination of functional groups and structural features may also impart specific electronic properties, making it suitable for various synthetic applications in organic chemistry. As with many heterocycles, the stability and reactivity of this compound can be influenced by the presence of substituents and the overall electronic environment.

Formula: C₁₀H₁₁BrN₂O₂

InChI: InChI=1S/C10H11BrN2O2/c1-10(2,3)9-13-6-7(15-9)5(14)4-12-8(6)11/h4,14H,1-3H3

InChI key: InChIKey=SHNYASFYGGUUPQ-UHFFFAOYSA-N

SMILES: BrC1=C2C(OC(C(C)(C)C)=N2)=C(O)C=N1

Synonyms:

• Oxazolo[4,5-c]pyridin-7-ol, 4-bromo-2-(1,1-dimethylethyl)-
• 4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridin-7-ol