CAS 1305324-81-5
:5-Chloro-6-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Description:
5-Chloro-6-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, which is a bicyclic heterocyclic structure. The presence of chlorine and iodine substituents at the 5 and 6 positions, respectively, contributes to its reactivity and potential applications in medicinal chemistry or materials science. The tris(1-methylethyl)silyl group enhances the compound's stability and solubility, making it suitable for various synthetic applications. This compound may exhibit interesting electronic properties due to the halogen substituents and the silyl group, which can influence its behavior in chemical reactions. Additionally, its molecular structure suggests potential interactions with biological targets, making it a candidate for further investigation in drug development. Overall, the combination of halogenation and silylation in this compound provides a versatile platform for exploring its chemical and biological properties.
Formula:C16H24ClIN2Si
InChI:InChI=1S/C16H24ClIN2Si/c1-10(2)21(11(3)4,12(5)6)20-8-7-13-9-14(17)15(18)19-16(13)20/h7-12H,1-6H3
InChI key:InChIKey=MJKXPRNUKVRSIS-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=CC(Cl)=C(I)N2
Synonyms:- 5-Chloro-6-iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-6-iodo-1-[tris(1-methylethyl)silyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.