CAS 1305324-83-7

5-Bromo-7-chloro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-c]pyridine

Description:

5-Bromo-7-chloro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-c]pyridine is a complex heterocyclic compound characterized by its unique pyrrolopyridine structure, which incorporates multiple halogen substituents (bromo, chloro, and iodo) and a phenylsulfonyl group. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in targeting specific enzymes or receptors. The presence of halogens can enhance lipophilicity and influence the compound's reactivity and interaction with biological systems. The phenylsulfonyl moiety may contribute to the compound's solubility and stability, making it suitable for various applications in pharmaceuticals. Additionally, the structural complexity of this compound suggests potential for diverse synthetic pathways and modifications, which can be explored for optimizing its pharmacological properties. Overall, 5-Bromo-7-chloro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-c]pyridine represents a significant interest in the field of organic synthesis and medicinal chemistry.

Formula: C₁₃H₇BrClIN₂O₂S

InChI: InChI=1S/C13H7BrClIN2O2S/c14-11-6-9-10(16)7-18(12(9)13(15)17-11)21(19,20)8-4-2-1-3-5-8/h1-7H

InChI key: InChIKey=CYNOGNVRHFRJDQ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C(I)=C1)=CC(Br)=NC2Cl)C3=CC=CC=C3

Synonyms:

• 5-Bromo-7-chloro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-c]pyridine
• 1H-Pyrrolo[2,3-c]pyridine, 5-bromo-7-chloro-3-iodo-1-(phenylsulfonyl)-