CAS 1305324-84-8
:4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine
Description:
4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine is a heterocyclic compound characterized by the presence of both a bromine atom and an oxazole ring fused to a pyridine structure. This compound features a bulky tert-butyl group (1,1-dimethylethyl) at the 2-position of the oxazole, which can influence its solubility and reactivity. The bromine substituent typically enhances the compound's reactivity in nucleophilic substitution reactions and can serve as a useful handle for further chemical modifications. The oxazolo[4,5-c]pyridine framework is known for its potential biological activity, making such compounds of interest in medicinal chemistry. Additionally, the presence of the oxazole ring may impart unique electronic properties, affecting the compound's interaction with biological targets. Overall, 4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine is a structurally complex molecule with potential applications in pharmaceuticals and materials science.
Formula:C10H11BrN2O
InChI:InChI=1S/C10H11BrN2O/c1-10(2,3)9-13-7-6(14-9)4-5-12-8(7)11/h4-5H,1-3H3
InChI key:InChIKey=FEKTXQGZQAJGIJ-UHFFFAOYSA-N
SMILES:BrC1=C2C(OC(C(C)(C)C)=N2)=CC=N1
Synonyms:- 4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine
- Oxazolo[4,5-c]pyridine, 4-bromo-2-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.