CAS 1305324-85-9
:5-Chloro-2,3-dimethoxy-4-pyridinemethanol
Description:
5-Chloro-2,3-dimethoxy-4-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of chlorine and methoxy groups contributes to its chemical reactivity and solubility properties. The methanol functional group indicates that the compound can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest that it could interact with various biological targets, possibly influencing enzyme activity or receptor binding. The chlorine substituent can also affect the electronic properties of the molecule, potentially altering its reactivity and stability. Overall, 5-Chloro-2,3-dimethoxy-4-pyridinemethanol is a complex molecule with potential applications in medicinal chemistry, and its specific characteristics would be further elucidated through experimental studies and computational modeling.
Formula:C8H10ClNO3
InChI:InChI=1S/C8H10ClNO3/c1-12-7-5(4-11)6(9)3-10-8(7)13-2/h3,11H,4H2,1-2H3
InChI key:InChIKey=XWRWXEJYFJSPML-UHFFFAOYSA-N
SMILES:O(C)C=1C(CO)=C(Cl)C=NC1OC
Synonyms:- 5-Chloro-2,3-dimethoxy-4-pyridinemethanol
- 4-Pyridinemethanol, 5-chloro-2,3-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.