CAS 1305324-86-0
:3,4-Diiodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Description:
3,4-Diiodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features two iodine atoms and a trifluoromethyl group, contributing to its unique chemical properties. The presence of iodine enhances its reactivity, particularly in electrophilic substitution reactions, while the trifluoromethyl group can influence its electronic properties and lipophilicity. The compound is likely to exhibit significant biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of halogens can affect the compound's stability and solubility in different solvents. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are essential when handling or utilizing this substance. Overall, 3,4-Diiodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine represents a valuable compound for research and development in chemical and biological applications.
Formula:C8H3F3I2N2
InChI:InChI=1S/C8H3F3I2N2/c9-8(10,11)3-1-14-7-5(6(3)13)4(12)2-15-7/h1-2H,(H,14,15)
InChI key:InChIKey=ZLYKZZFHRXJRHH-UHFFFAOYSA-N
SMILES:IC1=C2C(=NC=C1C(F)(F)F)NC=C2I
Synonyms:- 3,4-Diiodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 3,4-diiodo-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.