CAS 1305324-87-1
:4-Chloro-5-fluoro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
4-Chloro-5-fluoro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with various halogens and a phenylsulfonyl group. This compound features a pyridine ring fused to a pyrrole, contributing to its aromaticity and potential biological activity. The presence of chlorine, fluorine, and iodine atoms introduces significant electronegativity and steric effects, which can influence its reactivity and interactions with biological targets. The phenylsulfonyl moiety enhances its solubility and may improve its pharmacokinetic properties. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The unique combination of halogen substituents may also impart specific electronic properties, making it a candidate for further research in drug design and synthesis. Overall, this compound exemplifies the intricate balance of structure and function in the realm of organic chemistry.
Formula:C13H7ClFIN2O2S
InChI:InChI=1S/C13H7ClFIN2O2S/c14-12-9(15)6-17-13-11(12)10(16)7-18(13)21(19,20)8-4-2-1-3-5-8/h1-7H
InChI key:InChIKey=UCNMDGJGCWPQLN-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(I)=C1)=C(Cl)C(F)=CN2)C3=CC=CC=C3
Synonyms:- 4-Chloro-5-fluoro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-fluoro-3-iodo-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.