CAS 1305324-97-3
:6-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine
Description:
6-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with bromine and iodine atoms, as well as a phenylsulfonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents, which can participate in nucleophilic substitution reactions. The phenylsulfonyl group enhances its potential as a pharmacophore in medicinal chemistry, possibly contributing to its biological activity. The presence of multiple functional groups suggests that it may engage in various chemical interactions, making it of interest in drug development and synthetic chemistry. Additionally, the compound's unique structural features may impart specific electronic and steric properties, influencing its behavior in chemical reactions and interactions with biological targets. Overall, 6-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine represents a valuable compound for research in organic synthesis and medicinal applications.
Formula:C13H8BrIN2O2S
InChI:InChI=1S/C13H8BrIN2O2S/c14-9-6-12-13(16-7-9)11(15)8-17(12)20(18,19)10-4-2-1-3-5-10/h1-8H
InChI key:InChIKey=UGPXIJAFCPVHRH-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(I)=C1)=NC=C(Br)C2)C3=CC=CC=C3
Synonyms:- 6-Bromo-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine
- 1H-Pyrrolo[3,2-b]pyridine, 6-bromo-3-iodo-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.