CAS 1305324-98-4
:Pyridine, 2-bromo-3-methoxy-6-(methoxymethyl)-
Description:
Pyridine, 2-bromo-3-methoxy-6-(methoxymethyl)-, identified by its CAS number 1305324-98-4, is a heterocyclic organic compound featuring a pyridine ring substituted with various functional groups. The presence of bromine at the 2-position introduces a halogen, which can influence the compound's reactivity and polarity. The methoxy groups at the 3 and 6 positions enhance the compound's electron-donating properties, potentially affecting its solubility and interaction with other molecules. The methoxymethyl substituent at the 6-position adds steric bulk and may influence the compound's overall stability and reactivity. Pyridine derivatives are often utilized in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis due to their diverse chemical properties. The specific arrangement of substituents in this compound can lead to unique biological activities, making it of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and versatility of pyridine derivatives in chemical applications.
Formula:C8H10BrNO2
InChI:InChI=1S/C8H10BrNO2/c1-11-5-6-3-4-7(12-2)8(9)10-6/h3-4H,5H2,1-2H3
InChI key:InChIKey=GBGXVHJSYOHSJE-UHFFFAOYSA-N
SMILES:C(OC)C=1N=C(Br)C(OC)=CC1
Synonyms:- Pyridine, 2-bromo-3-methoxy-6-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.