CAS 1305325-00-1

4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine-7-carboxaldehyde

Description:

4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine-7-carboxaldehyde is a heterocyclic organic compound characterized by its complex structure, which includes a bromine atom, an oxazole ring, and a pyridine moiety. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, influencing its reactivity and solubility. This compound features a carboxaldehyde functional group, which is known for its reactivity in various chemical reactions, including nucleophilic additions and condensation reactions. The bromine substituent can also participate in electrophilic aromatic substitution reactions, making it a versatile intermediate in organic synthesis. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvents used. Overall, 4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine-7-carboxaldehyde is a valuable compound for research and development in various chemical applications.

Formula: C₁₁H₁₁BrN₂O₂

InChI: InChI=1S/C11H11BrN2O2/c1-11(2,3)10-14-7-8(16-10)6(5-15)4-13-9(7)12/h4-5H,1-3H3

InChI key: InChIKey=TYSYQBDXMCLVLO-UHFFFAOYSA-N

SMILES: C(=O)C1=C2C(N=C(C(C)(C)C)O2)=C(Br)N=C1

Synonyms:

• 4-Bromo-2-(1,1-dimethylethyl)oxazolo[4,5-c]pyridine-7-carboxaldehyde
• Oxazolo[4,5-c]pyridine-7-carboxaldehyde, 4-bromo-2-(1,1-dimethylethyl)-