CAS 1305325-02-3

4-Bromo-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine

Description:

4-Bromo-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine is a heterocyclic compound characterized by the presence of both bromine and iodine substituents on its oxazolo-pyridine framework. This compound features a fused ring system that includes a pyridine and an oxazole, contributing to its unique chemical properties. The presence of the bulky 1,1-dimethylethyl group enhances its steric hindrance, which can influence its reactivity and interactions with biological targets. The bromine and iodine atoms introduce halogen functionalities that can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, its structural complexity and the presence of multiple functional groups suggest potential applications in organic synthesis and material science. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and application.

Formula: C₁₀H₁₀BrIN₂O

InChI: InChI=1S/C10H10BrIN2O/c1-10(2,3)9-14-7-5(15-9)4-6(12)13-8(7)11/h4H,1-3H3

InChI key: InChIKey=LYQNSJIZUKTZCW-UHFFFAOYSA-N

SMILES: BrC1=C2C(OC(C(C)(C)C)=N2)=CC(I)=N1

Synonyms:

• Oxazolo[4,5-c]pyridine, 4-bromo-2-(1,1-dimethylethyl)-6-iodo-
• 4-Bromo-2-(1,1-dimethylethyl)-6-iodooxazolo[4,5-c]pyridine
• 4-Bromo-2-(tert-butyl)-6-iodooxazolo[4,5-c]pyridine