CAS 1305325-04-5

5-Bromo-3-iodo-1-(phenylsulfonyl)-2-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine

Description:

5-Bromo-3-iodo-1-(phenylsulfonyl)-2-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, which include a pyrrolo[2,3-b]pyridine core, bromine and iodine substituents, and a phenylsulfonyl group. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. This compound is likely to exhibit interesting reactivity due to the halogen atoms, which can participate in nucleophilic substitution reactions. Additionally, the sulfonyl group may influence its electronic properties and reactivity patterns. Given its structural complexity, this compound may be of interest in medicinal chemistry and material science, particularly in the development of pharmaceuticals or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they can vary based on the conditions and purity of the sample.

Formula: C₁₆H₁₆BrIN₂O₂SSi

InChI: InChI=1S/C16H16BrIN2O2SSi/c1-24(2,3)16-14(18)13-9-11(17)10-19-15(13)20(16)23(21,22)12-7-5-4-6-8-12/h4-10H,1-3H3

InChI key: InChIKey=ARHQHWSUQQJEAC-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C(I)=C1[Si](C)(C)C)=CC(Br)=CN2)C3=CC=CC=C3

Synonyms:

• 5-Bromo-3-iodo-1-(phenylsulfonyl)-2-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-3-iodo-1-(phenylsulfonyl)-2-(trimethylsilyl)-