CymitQuimica logo

CAS 1305325-05-6

:

1,1-Dimethylethyl 5-[2-(trimethylsilyl)ethynyl]-1H-pyrazolo[3,4-b]pyridine-1-carboxylate

Description:
1,1-Dimethylethyl 5-[2-(trimethylsilyl)ethynyl]-1H-pyrazolo[3,4-b]pyridine-1-carboxylate is a complex organic compound characterized by its unique structural features, including a pyrazolo[3,4-b]pyridine core, which contributes to its potential biological activity. The presence of a trimethylsilyl group enhances its stability and solubility, making it suitable for various chemical reactions and applications. This compound typically exhibits moderate to high lipophilicity due to the bulky tert-butyl group, which can influence its interaction with biological membranes. Additionally, the ethynyl group may impart reactivity, allowing for further functionalization. Its carboxylate moiety suggests potential for forming salts or participating in esterification reactions. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on the purity and the conditions under which it is studied. Overall, this substance is of interest in medicinal chemistry and materials science, particularly for its potential applications in drug development and synthesis.
Formula:C16H21N3O2Si
InChI:InChI=1S/C16H21N3O2Si/c1-16(2,3)21-15(20)19-14-13(11-18-19)9-12(10-17-14)7-8-22(4,5)6/h9-11H,1-6H3
InChI key:InChIKey=CEEFQZUQBYCYPE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(=CC(C#C[Si](C)(C)C)=CN2)C=N1
Synonyms:
  • 1,1-Dimethylethyl 5-[2-(trimethylsilyl)ethynyl]-1H-pyrazolo[3,4-b]pyridine-1-carboxylate
  • 1H-Pyrazolo[3,4-b]pyridine-1-carboxylic acid, 5-[2-(trimethylsilyl)ethynyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.