CAS 1305325-10-3

2-(1,1-Dimethylethyl)oxazolo[4,5-c]pyridin-7-ol

Description:

2-(1,1-Dimethylethyl)oxazolo[4,5-c]pyridin-7-ol is a chemical compound characterized by its unique structural features, which include an oxazole ring fused to a pyridine moiety. This compound contains a hydroxyl group (-OH) at the 7-position of the pyridine ring, contributing to its potential reactivity and solubility in polar solvents. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity and steric bulk, which may influence its biological activity and interactions with other molecules. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both heterocyclic and functional groups that can participate in various chemical reactions. Additionally, the oxazole and pyridine rings may impart specific electronic properties, making it a candidate for further study in areas such as drug design or as a ligand in coordination chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-10(2,3)9-12-6-4-11-5-7(13)8(6)14-9/h4-5,13H,1-3H3

InChI key: InChIKey=WHRWLBNMDGQNEZ-UHFFFAOYSA-N

SMILES: OC1=C2C(N=C(C(C)(C)C)O2)=CN=C1

Synonyms:

• 2-(1,1-Dimethylethyl)oxazolo[4,5-c]pyridin-7-ol
• Oxazolo[4,5-c]pyridin-7-ol, 2-(1,1-dimethylethyl)-