CAS 1305325-21-6

4,4-Difluoro-1-methyl-L-proline

Description:

4,4-Difluoro-1-methyl-L-proline is an amino acid derivative characterized by the presence of two fluorine atoms at the 4-position of the proline ring and a methyl group at the 1-position. This compound is notable for its unique structural features, which can influence its biological activity and interactions. The introduction of fluorine atoms often enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry and drug design. The L-proline backbone contributes to its potential role in peptide synthesis and as a building block for various pharmaceuticals. Additionally, the presence of the methyl group can affect the steric and electronic properties of the molecule, potentially influencing its conformation and reactivity. As a chiral compound, it exists in specific stereoisomeric forms, which can have different biological effects. Overall, 4,4-Difluoro-1-methyl-L-proline represents a valuable compound for research in organic synthesis and pharmaceutical applications.

Formula: C₆H₉F₂NO₂

InChI: InChI=1S/C6H9F2NO2/c1-9-3-6(7,8)2-4(9)5(10)11/h4H,2-3H2,1H3,(H,10,11)/t4-/m0/s1

InChI key: InChIKey=CWWIFJQKJYXFQK-BYPYZUCNSA-N

SMILES: C(O)(=O)[C@@H]1CC(F)(F)CN1C

Synonyms:

• (2S)-4,4-Difluoro-1-methylpyrrolidine-2-carboxylic acid
• L-Proline, 4,4-difluoro-1-methyl-
• 4,4-Difluoro-1-methyl-L-proline