CAS 1305325-23-8

6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine

Description:

6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with a bromine atom and a phenylsulfonyl group. This compound typically exhibits a molecular formula that reflects its multiple functional groups, contributing to its unique chemical properties. The presence of the bromine atom introduces halogen characteristics, such as increased reactivity and potential for electrophilic substitution. The phenylsulfonyl group enhances the compound's solubility in organic solvents and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the pyrrolopyridine framework is known for its potential applications in pharmaceuticals, particularly in the development of compounds with anti-cancer or anti-inflammatory properties. The compound's synthesis and reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₃H₉BrN₂O₂S

InChI: InChI=1S/C13H9BrN2O2S/c14-10-8-13-12(15-9-10)6-7-16(13)19(17,18)11-4-2-1-3-5-11/h1-9H

InChI key: InChIKey=ZFAXLERNOAWMMA-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(C=C1)=NC=C(Br)C2)C3=CC=CC=C3

Synonyms:

• 1-(Benzenesulfonyl)-6-bromopyrrolo[3,2-b]pyridine
• 1H-Pyrrolo[3,2-b]pyridine, 6-bromo-1-(phenylsulfonyl)-
• 1-(Phenylsulfonyl)-6-bromopyrrolo[3,2-b]pyridine
• 6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine

6-Bromo-1-(phenylsulfonyl)-1h-pyrrolo[3,2-b]pyridine

CAS: 1305325-23-8

Formula: C₁₃H₉BrN₂O₂S

Purity: 97%

Molecular weight: 337.1918

Ref: IN-DA00HS3V

6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine

CAS: 1305325-23-8

Purity: 97%

Molecular weight: 337.1900024

Ref: 10-F768258