CAS 1305325-24-9

N-[2-Chloro-6-iodo-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[2-Chloro-6-iodo-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom, an iodine atom, and a trimethylsilyl group. The presence of these halogen substituents suggests potential reactivity and influence on the compound's electronic properties. The amide functional group contributes to its polarity and solubility characteristics, making it potentially useful in various chemical reactions and applications. The trimethylsilyl group can enhance the compound's stability and may also facilitate certain synthetic pathways. This compound may be of interest in medicinal chemistry or materials science due to its unique structural features. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed literature reference for precise characterization. Overall, the compound's unique combination of functional groups and substituents suggests a versatile role in chemical synthesis and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₃H₂₀ClIN₂OSi

InChI: InChI=1S/C13H20ClIN2OSi/c1-13(2,3)12(18)17-10-8(19(4,5)6)7-9(15)16-11(10)14/h7H,1-6H3,(H,17,18)

InChI key: InChIKey=RNWJJAPSSGPPDV-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C=1C([Si](C)(C)C)=CC(I)=NC1Cl

Synonyms:

• Propanamide, N-[2-chloro-6-iodo-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethyl-
• N-[2-Chloro-6-iodo-4-(trimethylsilyl)-3-pyridinyl]-2,2-dimethylpropanamide
• N-(2-Chloro-6-iodo-4-(trimethylsilyl)-pyridin-3-yl)pivalamide
• N-(2-chloro-6-iodo-4-trimethylsilylpyridin-3-yl)-2,2-dimethylpropanamide