CAS 1305332-66-4

1,1-Dimethylethyl 5-(3-methoxy-3-oxo-1-propen-1-yl)-1H-pyrazolo[3,4-b]pyridine-1-carboxylate

Description:

1,1-Dimethylethyl 5-(3-methoxy-3-oxo-1-propen-1-yl)-1H-pyrazolo[3,4-b]pyridine-1-carboxylate, identified by its CAS number 1305332-66-4, is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a carboxylate functional group and a dimethyl substituent, contributing to its unique reactivity and potential biological activity. The presence of a methoxy group and an α,β-unsaturated carbonyl moiety suggests that it may participate in various chemical reactions, including nucleophilic additions and Michael additions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often associated with bioactive compounds. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrazole and pyridine rings, making it a subject of interest for further research in organic synthesis and drug discovery.

Formula: C₁₅H₁₇N₃O₄

InChI: InChI=1S/C15H17N3O4/c1-15(2,3)22-14(20)18-13-11(9-17-18)7-10(8-16-13)5-6-12(19)21-4/h5-9H,1-4H3

InChI key: InChIKey=WNHSOUPHNZQQCV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2C(=CC(C=CC(OC)=O)=CN2)C=N1