CymitQuimica logo

CAS 13054-44-9

:

Ethyl α-oxo-2-benzoxazolepropanoate

Description:
Ethyl α-oxo-2-benzoxazolepropanoate, with the CAS number 13054-44-9, is an organic compound characterized by its unique structure that includes a benzoxazole ring and an ester functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, making it useful in various chemical applications. Ethyl α-oxo-2-benzoxazolepropanoate is known for its potential biological activities, which may include antimicrobial and anti-inflammatory properties, although specific biological effects can vary based on concentration and conditions. The presence of the α-oxo group contributes to its reactivity, allowing it to participate in various chemical reactions, including condensation and acylation. Additionally, the compound may serve as an intermediate in the synthesis of other organic molecules, particularly in pharmaceutical chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c1-2-16-12(15)9(14)7-11-13-8-5-3-4-6-10(8)17-11/h3-6H,2,7H2,1H3
InChI key:InChIKey=DHRXLBCXCVKHKO-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)=O)C1=NC=2C(O1)=CC=CC2
Synonyms:
  • 2-Benzoxazolepropanoic acid, α-oxo-, ethyl ester
  • Ethyl α-oxo-2-benzoxazolepropanoate
  • 2-Benzoxazolepyruvic acid, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.