CAS 130548-10-6
:(3S)-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione
Description:
(3S)-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione is a complex organic compound characterized by its unique polycyclic structure, which includes multiple fused aromatic rings. This compound features a methoxy group and a methyl group, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the diketone functional groups (trione) indicates that it may participate in various chemical reactions, such as condensation or oxidation. The stereochemistry denoted by (3S) suggests specific spatial arrangements of atoms, which can influence the compound's physical properties and biological activity. Typically, compounds of this nature may exhibit interesting optical properties and could be explored for their potential in materials science or medicinal chemistry. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C20H16O4
InChI:InChI=1/C20H16O4/c1-10-8-11-6-7-13-18(16(11)14(21)9-10)20(23)12-4-3-5-15(24-2)17(12)19(13)22/h3-7,10H,8-9H2,1-2H3/t10-/m0/s1
SMILES:C[C@H]1Cc2ccc3c(c2C(=O)C1)C(=O)c1cccc(c1C3=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-8-methoxy-3-methyl-, (3S)-
CAS:Formula:C20H16O4Color and Shape:SolidMolecular weight:320.3386


